About 5-(3-bromophenyl)-4,6-dichloro-2-pyridin-3-ylpyrimidine
5-(3-bromophenyl)-4,6-dichloro-2-pyridin-3-ylpyrimidine (PubChem CID 79431669) has the molecular formula C15H8BrCl2N3
and a molecular weight of 381.06 g/mol. Its IUPAC name is 5-(3-bromophenyl)-4,6-dichloro-2-pyridin-3-ylpyrimidine.
Molecular Properties
| Compound Name | 5-(3-bromophenyl)-4,6-dichloro-2-pyridin-3-ylpyrimidine |
| PubChem CID | 79431669 |
| Molecular Formula | C15H8BrCl2N3 |
| Molecular Weight | 381.06 g/mol |
| Exact Mass | 378.93 |
| IUPAC Name | 5-(3-bromophenyl)-4,6-dichloro-2-pyridin-3-ylpyrimidine |
| SMILES | Clc1nc(-c2cccnc2)nc(Cl)c1-c1cccc(Br)c1 |
| InChI | InChI=1S/C15H8BrCl2N3/c16-11-5-1-3-9(7-11)12-13(17)20-15(21-14(12)18)10-4-2-6-19-8-10/h1-8H |
| InChIKey | NONGCRZMRXNNRV-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.06 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(3-bromophenyl)-4,6-dichloro-2-pyridin-3-ylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-bromophenyl)-4,6-dichloro-2-pyridin-3-ylpyrimidine?
The IUPAC name of 5-(3-bromophenyl)-4,6-dichloro-2-pyridin-3-ylpyrimidine (CID 79431669) is 5-(3-bromophenyl)-4,6-dichloro-2-pyridin-3-ylpyrimidine.
What is the SMILES notation for 5-(3-bromophenyl)-4,6-dichloro-2-pyridin-3-ylpyrimidine?
The canonical SMILES for 5-(3-bromophenyl)-4,6-dichloro-2-pyridin-3-ylpyrimidine is Clc1nc(-c2cccnc2)nc(Cl)c1-c1cccc(Br)c1.
What is the InChIKey of 5-(3-bromophenyl)-4,6-dichloro-2-pyridin-3-ylpyrimidine?
The InChIKey is NONGCRZMRXNNRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8BrCl2N3/c16-11-5-1-3-9(7-11)12-13(17)20-15(21-14(12)18)10-4-2-6-19-8-10/h1-8H.
What are the key properties of 5-(3-bromophenyl)-4,6-dichloro-2-pyridin-3-ylpyrimidine?
5-(3-bromophenyl)-4,6-dichloro-2-pyridin-3-ylpyrimidine has a molecular weight of 381.06 g/mol, XLogP of 5.27, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-bromophenyl)-4,6-dichloro-2-pyridin-3-ylpyrimidine is sourced from PubChem (CID 79431669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).