C36H23BrN6 — CID 155195987
2-(3-bromo-5-pyridin-3-ylphenyl)-4,6-bis(4-pyridin-3-ylphenyl)-1,3,5-triazine (PubChem CID 155195987) has the molecular formula C36H23BrN6 and a molecular weight of 619.53 g/mol. Its IUPAC name is 2-(3-bromo-5-pyridin-3-ylphenyl)-4,6-bis(4-pyridin-3-ylphenyl)-1,3,5-triazine.
| Compound Name | 2-(3-bromo-5-pyridin-3-ylphenyl)-4,6-bis(4-pyridin-3-ylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 155195987 |
| Molecular Formula | C36H23BrN6 |
| Molecular Weight | 619.53 g/mol |
| Exact Mass | 618.12 |
| IUPAC Name | 2-(3-bromo-5-pyridin-3-ylphenyl)-4,6-bis(4-pyridin-3-ylphenyl)-1,3,5-triazine |
| SMILES | Brc1cc(-c2cccnc2)cc(-c2nc(-c3ccc(-c4cccnc4)cc3)nc(-c3ccc(-c4cccnc4)cc3)n2)c1 |
| InChI | InChI=1S/C36H23BrN6/c37-33-19-31(30-6-3-17-40-23-30)18-32(20-33)36-42-34(26-11-7-24(8-12-26)28-4-1-15-38-21-28)41-35(43-36)27-13-9-25(10-14-27)29-5-2-16-39-22-29/h1-23H |
| InChIKey | PHRLWMSLNDRWIS-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.53 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |