C32H19BrN4O — CID 150429828
2-(3-bromo-5-pyridin-3-ylphenyl)-4-dibenzofuran-2-yl-6-phenyl-1,3,5-triazine (PubChem CID 150429828) has the molecular formula C32H19BrN4O and a molecular weight of 555.44 g/mol. Its IUPAC name is 2-(3-bromo-5-pyridin-3-ylphenyl)-4-dibenzofuran-2-yl-6-phenyl-1,3,5-triazine.
| Compound Name | 2-(3-bromo-5-pyridin-3-ylphenyl)-4-dibenzofuran-2-yl-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 150429828 |
| Molecular Formula | C32H19BrN4O |
| Molecular Weight | 555.44 g/mol |
| Exact Mass | 554.07 |
| IUPAC Name | 2-(3-bromo-5-pyridin-3-ylphenyl)-4-dibenzofuran-2-yl-6-phenyl-1,3,5-triazine |
| SMILES | Brc1cc(-c2cccnc2)cc(-c2nc(-c3ccccc3)nc(-c3ccc4oc5ccccc5c4c3)n2)c1 |
| InChI | InChI=1S/C32H19BrN4O/c33-25-16-23(22-9-6-14-34-19-22)15-24(17-25)32-36-30(20-7-2-1-3-8-20)35-31(37-32)21-12-13-29-27(18-21)26-10-4-5-11-28(26)38-29/h1-19H |
| InChIKey | HJNZBBDAQAHUDN-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.44 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |