C14H13BrCl2N2 — CID 79440195
5-(3-bromophenyl)-2-tert-butyl-4,6-dichloropyrimidine (PubChem CID 79440195) has the molecular formula C14H13BrCl2N2 and a molecular weight of 360.08 g/mol. Its IUPAC name is 5-(3-bromophenyl)-2-tert-butyl-4,6-dichloropyrimidine.
| Compound Name | 5-(3-bromophenyl)-2-tert-butyl-4,6-dichloropyrimidine |
|---|---|
| PubChem CID | 79440195 |
| Molecular Formula | C14H13BrCl2N2 |
| Molecular Weight | 360.08 g/mol |
| Exact Mass | 357.96 |
| IUPAC Name | 5-(3-bromophenyl)-2-tert-butyl-4,6-dichloropyrimidine |
| SMILES | CC(C)(C)c1nc(Cl)c(-c2cccc(Br)c2)c(Cl)n1 |
| InChI | InChI=1S/C14H13BrCl2N2/c1-14(2,3)13-18-11(16)10(12(17)19-13)8-5-4-6-9(15)7-8/h4-7H,1-3H3 |
| InChIKey | OBAQLOBDHNYSCK-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.08 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |