C15H15BrCl2N2 — CID 79440504
5-(3-bromophenyl)-4,6-dichloro-2-(3-methylbutyl)pyrimidine (PubChem CID 79440504) has the molecular formula C15H15BrCl2N2 and a molecular weight of 374.11 g/mol. Its IUPAC name is 5-(3-bromophenyl)-4,6-dichloro-2-(3-methylbutyl)pyrimidine.
| Compound Name | 5-(3-bromophenyl)-4,6-dichloro-2-(3-methylbutyl)pyrimidine |
|---|---|
| PubChem CID | 79440504 |
| Molecular Formula | C15H15BrCl2N2 |
| Molecular Weight | 374.11 g/mol |
| Exact Mass | 371.98 |
| IUPAC Name | 5-(3-bromophenyl)-4,6-dichloro-2-(3-methylbutyl)pyrimidine |
| SMILES | CC(C)CCc1nc(Cl)c(-c2cccc(Br)c2)c(Cl)n1 |
| InChI | InChI=1S/C15H15BrCl2N2/c1-9(2)6-7-12-19-14(17)13(15(18)20-12)10-4-3-5-11(16)8-10/h3-5,8-9H,6-7H2,1-2H3 |
| InChIKey | XFLQNRZNBCRMSZ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.11 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |