C16H10N2S — CID 13407323
2-pyridin-3-ylbenzo[e][1,3]benzothiazole (PubChem CID 13407323) has the molecular formula C16H10N2S and a molecular weight of 262.34 g/mol. Its IUPAC name is 2-pyridin-3-ylbenzo[e][1,3]benzothiazole.
| Compound Name | 2-pyridin-3-ylbenzo[e][1,3]benzothiazole |
|---|---|
| PubChem CID | 13407323 |
| Molecular Formula | C16H10N2S |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 2-pyridin-3-ylbenzo[e][1,3]benzothiazole |
| SMILES | c1cncc(-c2nc3c(ccc4ccccc43)s2)c1 |
| InChI | InChI=1S/C16H10N2S/c1-2-6-13-11(4-1)7-8-14-15(13)18-16(19-14)12-5-3-9-17-10-12/h1-10H |
| InChIKey | JRAZYJVQRBJJDE-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |