C14H13N3OS — CID 82190401
2-[(2-pyridin-3-yl-1,3-benzothiazol-4-yl)oxy]ethanamine (PubChem CID 82190401) has the molecular formula C14H13N3OS and a molecular weight of 271.34 g/mol. Its IUPAC name is 2-[(2-pyridin-3-yl-1,3-benzothiazol-4-yl)oxy]ethanamine.
| Compound Name | 2-[(2-pyridin-3-yl-1,3-benzothiazol-4-yl)oxy]ethanamine |
|---|---|
| PubChem CID | 82190401 |
| Molecular Formula | C14H13N3OS |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 2-[(2-pyridin-3-yl-1,3-benzothiazol-4-yl)oxy]ethanamine |
| SMILES | NCCOc1cccc2sc(-c3cccnc3)nc12 |
| InChI | InChI=1S/C14H13N3OS/c15-6-8-18-11-4-1-5-12-13(11)17-14(19-12)10-3-2-7-16-9-10/h1-5,7,9H,6,8,15H2 |
| InChIKey | RMWXWCZNUFYYEW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |