C17H18N2OS — CID 82190331
4-[(2-phenyl-1,3-benzothiazol-4-yl)oxy]butan-1-amine (PubChem CID 82190331) has the molecular formula C17H18N2OS and a molecular weight of 298.41 g/mol. Its IUPAC name is 4-[(2-phenyl-1,3-benzothiazol-4-yl)oxy]butan-1-amine.
| Compound Name | 4-[(2-phenyl-1,3-benzothiazol-4-yl)oxy]butan-1-amine |
|---|---|
| PubChem CID | 82190331 |
| Molecular Formula | C17H18N2OS |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 4-[(2-phenyl-1,3-benzothiazol-4-yl)oxy]butan-1-amine |
| SMILES | NCCCCOc1cccc2sc(-c3ccccc3)nc12 |
| InChI | InChI=1S/C17H18N2OS/c18-11-4-5-12-20-14-9-6-10-15-16(14)19-17(21-15)13-7-2-1-3-8-13/h1-3,6-10H,4-5,11-12,18H2 |
| InChIKey | BDKBGJBNOZKUJC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|