C13H18N2OS — CID 82190296
2-[(2-butyl-1,3-benzothiazol-4-yl)oxy]ethanamine (PubChem CID 82190296) has the molecular formula C13H18N2OS and a molecular weight of 250.37 g/mol. Its IUPAC name is 2-[(2-butyl-1,3-benzothiazol-4-yl)oxy]ethanamine.
| Compound Name | 2-[(2-butyl-1,3-benzothiazol-4-yl)oxy]ethanamine |
|---|---|
| PubChem CID | 82190296 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 2-[(2-butyl-1,3-benzothiazol-4-yl)oxy]ethanamine |
| SMILES | CCCCc1nc2c(OCCN)cccc2s1 |
| InChI | InChI=1S/C13H18N2OS/c1-2-3-7-12-15-13-10(16-9-8-14)5-4-6-11(13)17-12/h4-6H,2-3,7-9,14H2,1H3 |
| InChIKey | DCIHCFKQGWQMFM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |