C17H27N3OS — CID 154476426
(4-decoxy-1,3-benzothiazol-2-yl)hydrazine (PubChem CID 154476426) has the molecular formula C17H27N3OS and a molecular weight of 321.49 g/mol. Its IUPAC name is (4-decoxy-1,3-benzothiazol-2-yl)hydrazine.
| Compound Name | (4-decoxy-1,3-benzothiazol-2-yl)hydrazine |
|---|---|
| PubChem CID | 154476426 |
| Molecular Formula | C17H27N3OS |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | (4-decoxy-1,3-benzothiazol-2-yl)hydrazine |
| SMILES | CCCCCCCCCCOc1cccc2sc(NN)nc12 |
| InChI | InChI=1S/C17H27N3OS/c1-2-3-4-5-6-7-8-9-13-21-14-11-10-12-15-16(14)19-17(20-18)22-15/h10-12H,2-9,13,18H2,1H3,(H,19,20) |
| InChIKey | HDFHAVOTDLECCJ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|