C13H17NOS — CID 54068927
4-hexoxy-1,3-benzothiazole (PubChem CID 54068927) has the molecular formula C13H17NOS and a molecular weight of 235.35 g/mol. Its IUPAC name is 4-hexoxy-1,3-benzothiazole.
| Compound Name | 4-hexoxy-1,3-benzothiazole |
|---|---|
| PubChem CID | 54068927 |
| Molecular Formula | C13H17NOS |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 4-hexoxy-1,3-benzothiazole |
| SMILES | CCCCCCOc1cccc2scnc12 |
| InChI | InChI=1S/C13H17NOS/c1-2-3-4-5-9-15-11-7-6-8-12-13(11)14-10-16-12/h6-8,10H,2-5,9H2,1H3 |
| InChIKey | KDMFUUXFPUIFOO-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|