About 4-hexoxy-1,3-benzothiazole
4-hexoxy-1,3-benzothiazole (PubChem CID 54068927) has the molecular formula C13H17NOS
and a molecular weight of 235.35 g/mol. Its IUPAC name is 4-hexoxy-1,3-benzothiazole.
Molecular Properties
| Compound Name | 4-hexoxy-1,3-benzothiazole |
| PubChem CID | 54068927 |
| Molecular Formula | C13H17NOS |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 4-hexoxy-1,3-benzothiazole |
| SMILES | CCCCCCOc1cccc2scnc12 |
| InChI | InChI=1S/C13H17NOS/c1-2-3-4-5-9-15-11-7-6-8-12-13(11)14-10-16-12/h6-8,10H,2-5,9H2,1H3 |
| InChIKey | KDMFUUXFPUIFOO-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-hexoxy-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hexoxy-1,3-benzothiazole?
The IUPAC name of 4-hexoxy-1,3-benzothiazole (CID 54068927) is 4-hexoxy-1,3-benzothiazole.
What is the SMILES notation for 4-hexoxy-1,3-benzothiazole?
The canonical SMILES for 4-hexoxy-1,3-benzothiazole is CCCCCCOc1cccc2scnc12.
What is the InChIKey of 4-hexoxy-1,3-benzothiazole?
The InChIKey is KDMFUUXFPUIFOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NOS/c1-2-3-4-5-9-15-11-7-6-8-12-13(11)14-10-16-12/h6-8,10H,2-5,9H2,1H3.
What are the key properties of 4-hexoxy-1,3-benzothiazole?
4-hexoxy-1,3-benzothiazole has a molecular weight of 235.35 g/mol, XLogP of 4.26, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hexoxy-1,3-benzothiazole is sourced from PubChem (CID 54068927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).