C21H14N4O2S — CID 11494754
13-methyl-11-(4-phenylphenyl)-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,6-dione (PubChem CID 11494754) has the molecular formula C21H14N4O2S and a molecular weight of 386.44 g/mol. Its IUPAC name is 13-methyl-11-(4-phenylphenyl)-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,6-dione.
| Compound Name | 13-methyl-11-(4-phenylphenyl)-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,6-dione |
|---|---|
| PubChem CID | 11494754 |
| Molecular Formula | C21H14N4O2S |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 13-methyl-11-(4-phenylphenyl)-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,6-dione |
| SMILES | Cc1nc(-c2ccc(-c3ccccc3)cc2)nc2sc3c(=O)[nH]c(=O)[nH]c3c12 |
| InChI | InChI=1S/C21H14N4O2S/c1-11-15-16-17(19(26)25-21(27)23-16)28-20(15)24-18(22-11)14-9-7-13(8-10-14)12-5-3-2-4-6-12/h2-10H,1H3,(H2,23,25,26,27) |
| InChIKey | AIIWACFXWMHKPM-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |