C18H12ClN3O2S2 — CID 11211789
12-acetyl-13-(4-chlorophenyl)-11-methyl-4-sulfanylidene-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-6-one (PubChem CID 11211789) has the molecular formula C18H12ClN3O2S2 and a molecular weight of 401.90 g/mol. Its IUPAC name is 12-acetyl-13-(4-chlorophenyl)-11-methyl-4-sulfanylidene-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-6-one.
| Compound Name | 12-acetyl-13-(4-chlorophenyl)-11-methyl-4-sulfanylidene-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-6-one |
|---|---|
| PubChem CID | 11211789 |
| Molecular Formula | C18H12ClN3O2S2 |
| Molecular Weight | 401.90 g/mol |
| Exact Mass | 401.01 |
| IUPAC Name | 12-acetyl-13-(4-chlorophenyl)-11-methyl-4-sulfanylidene-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-6-one |
| SMILES | CC(=O)c1c(C)nc2sc3c(=O)[nH]c(=S)[nH]c3c2c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H12ClN3O2S2/c1-7-11(8(2)23)12(9-3-5-10(19)6-4-9)13-14-15(26-17(13)20-7)16(24)22-18(25)21-14/h3-6H,1-2H3,(H2,21,22,24,25) |
| InChIKey | WWNYGBSPVXSRPR-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 78.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.90 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|