C20H16ClN3OS — CID 135422446
9-(4-chlorophenyl)-13-methyl-17-thia-2,12,14-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),12-pentaen-15-one (PubChem CID 135422446) has the molecular formula C20H16ClN3OS and a molecular weight of 381.89 g/mol. Its IUPAC name is 9-(4-chlorophenyl)-13-methyl-17-thia-2,12,14-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),12-pentaen-15-one.
| Compound Name | 9-(4-chlorophenyl)-13-methyl-17-thia-2,12,14-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),12-pentaen-15-one |
|---|---|
| PubChem CID | 135422446 |
| Molecular Formula | C20H16ClN3OS |
| Molecular Weight | 381.89 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 9-(4-chlorophenyl)-13-methyl-17-thia-2,12,14-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),12-pentaen-15-one |
| SMILES | Cc1nc2c(sc3nc4c(c(-c5ccc(Cl)cc5)c32)CCCC4)c(=O)[nH]1 |
| InChI | InChI=1S/C20H16ClN3OS/c1-10-22-17-16-15(11-6-8-12(21)9-7-11)13-4-2-3-5-14(13)24-20(16)26-18(17)19(25)23-10/h6-9H,2-5H2,1H3,(H,22,23,25) |
| InChIKey | NZXSKJZHBGEUAW-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.89 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |