C18H14N4OS — CID 136679886
9-phenyl-17-thia-2,12,13,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),12-pentaen-15-one (PubChem CID 136679886) has the molecular formula C18H14N4OS and a molecular weight of 334.40 g/mol. Its IUPAC name is 9-phenyl-17-thia-2,12,13,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),12-pentaen-15-one.
| Compound Name | 9-phenyl-17-thia-2,12,13,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),12-pentaen-15-one |
|---|---|
| PubChem CID | 136679886 |
| Molecular Formula | C18H14N4OS |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 9-phenyl-17-thia-2,12,13,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),12-pentaen-15-one |
| SMILES | O=c1[nH]nnc2c1sc1nc3c(c(-c4ccccc4)c12)CCCC3 |
| InChI | InChI=1S/C18H14N4OS/c23-17-16-15(20-22-21-17)14-13(10-6-2-1-3-7-10)11-8-4-5-9-12(11)19-18(14)24-16/h1-3,6-7H,4-5,8-9H2,(H,20,21,23) |
| InChIKey | ZPFIIJQEYOIDSQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |