C19H16N4O2S — CID 135855684
9-(4-methoxyphenyl)-17-thia-2,12,13,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),12-pentaen-15-one (PubChem CID 135855684) has the molecular formula C19H16N4O2S and a molecular weight of 364.43 g/mol. Its IUPAC name is 9-(4-methoxyphenyl)-17-thia-2,12,13,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),12-pentaen-15-one.
| Compound Name | 9-(4-methoxyphenyl)-17-thia-2,12,13,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),12-pentaen-15-one |
|---|---|
| PubChem CID | 135855684 |
| Molecular Formula | C19H16N4O2S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 9-(4-methoxyphenyl)-17-thia-2,12,13,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),12-pentaen-15-one |
| SMILES | COc1ccc(-c2c3c(nc4sc5c(=O)[nH]nnc5c24)CCCC3)cc1 |
| InChI | InChI=1S/C19H16N4O2S/c1-25-11-8-6-10(7-9-11)14-12-4-2-3-5-13(12)20-19-15(14)16-17(26-19)18(24)22-23-21-16/h6-9H,2-5H2,1H3,(H,21,22,24) |
| InChIKey | QQLZVCGEFDPJCQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |