C26H20N2O2S2 — CID 10411760
16-(4-methoxyphenyl)-5-phenyl-4-sulfanylidene-8-thia-5,10-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2(7),9,11(15)-tetraen-6-one (PubChem CID 10411760) has the molecular formula C26H20N2O2S2 and a molecular weight of 456.59 g/mol. Its IUPAC name is 16-(4-methoxyphenyl)-5-phenyl-4-sulfanylidene-8-thia-5,10-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2(7),9,11(15)-tetraen-6-one.
| Compound Name | 16-(4-methoxyphenyl)-5-phenyl-4-sulfanylidene-8-thia-5,10-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2(7),9,11(15)-tetraen-6-one |
|---|---|
| PubChem CID | 10411760 |
| Molecular Formula | C26H20N2O2S2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | 16-(4-methoxyphenyl)-5-phenyl-4-sulfanylidene-8-thia-5,10-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2(7),9,11(15)-tetraen-6-one |
| SMILES | COc1ccc(-c2c3c(nc4sc5c(c24)CC(=S)N(c2ccccc2)C5=O)CCC3)cc1 |
| InChI | InChI=1S/C26H20N2O2S2/c1-30-17-12-10-15(11-13-17)22-18-8-5-9-20(18)27-25-23(22)19-14-21(31)28(26(29)24(19)32-25)16-6-3-2-4-7-16/h2-4,6-7,10-13H,5,8-9,14H2,1H3 |
| InChIKey | DVOIAZKJMIOTMI-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|