About 5,7-bis(4-chlorophenyl)-2-sulfanylidene-1H-pyrido[2,3-d]pyrimidin-4-one
5,7-bis(4-chlorophenyl)-2-sulfanylidene-1H-pyrido[2,3-d]pyrimidin-4-one (PubChem CID 6199734) has the molecular formula C19H11Cl2N3OS
and a molecular weight of 400.29 g/mol. Its IUPAC name is 5,7-bis(4-chlorophenyl)-2-sulfanylidene-1H-pyrido[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 5,7-bis(4-chlorophenyl)-2-sulfanylidene-1H-pyrido[2,3-d]pyrimidin-4-one |
| PubChem CID | 6199734 |
| Molecular Formula | C19H11Cl2N3OS |
| Molecular Weight | 400.29 g/mol |
| Exact Mass | 399.00 |
| IUPAC Name | 5,7-bis(4-chlorophenyl)-2-sulfanylidene-1H-pyrido[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(=S)[nH]c2nc(-c3ccc(Cl)cc3)cc(-c3ccc(Cl)cc3)c12 |
| InChI | InChI=1S/C19H11Cl2N3OS/c20-12-5-1-10(2-6-12)14-9-15(11-3-7-13(21)8-4-11)22-17-16(14)18(25)24-19(26)23-17/h1-9H,(H2,22,23,24,25,26) |
| InChIKey | MMAPUYFVVQUKML-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.29 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5,7-bis(4-chlorophenyl)-2-sulfanylidene-1H-pyrido[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-bis(4-chlorophenyl)-2-sulfanylidene-1H-pyrido[2,3-d]pyrimidin-4-one?
The IUPAC name of 5,7-bis(4-chlorophenyl)-2-sulfanylidene-1H-pyrido[2,3-d]pyrimidin-4-one (CID 6199734) is 5,7-bis(4-chlorophenyl)-2-sulfanylidene-1H-pyrido[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 5,7-bis(4-chlorophenyl)-2-sulfanylidene-1H-pyrido[2,3-d]pyrimidin-4-one?
The canonical SMILES for 5,7-bis(4-chlorophenyl)-2-sulfanylidene-1H-pyrido[2,3-d]pyrimidin-4-one is O=c1[nH]c(=S)[nH]c2nc(-c3ccc(Cl)cc3)cc(-c3ccc(Cl)cc3)c12.
What is the InChIKey of 5,7-bis(4-chlorophenyl)-2-sulfanylidene-1H-pyrido[2,3-d]pyrimidin-4-one?
The InChIKey is MMAPUYFVVQUKML-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H11Cl2N3OS/c20-12-5-1-10(2-6-12)14-9-15(11-3-7-13(21)8-4-11)22-17-16(14)18(25)24-19(26)23-17/h1-9H,(H2,22,23,24,25,26).
What are the key properties of 5,7-bis(4-chlorophenyl)-2-sulfanylidene-1H-pyrido[2,3-d]pyrimidin-4-one?
5,7-bis(4-chlorophenyl)-2-sulfanylidene-1H-pyrido[2,3-d]pyrimidin-4-one has a molecular weight of 400.29 g/mol, XLogP of 5.62, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-bis(4-chlorophenyl)-2-sulfanylidene-1H-pyrido[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 6199734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).