C19H11Cl2N3OS — CID 6199734
5,7-bis(4-chlorophenyl)-2-sulfanylidene-1H-pyrido[2,3-d]pyrimidin-4-one (PubChem CID 6199734) has the molecular formula C19H11Cl2N3OS and a molecular weight of 400.29 g/mol. Its IUPAC name is 5,7-bis(4-chlorophenyl)-2-sulfanylidene-1H-pyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 5,7-bis(4-chlorophenyl)-2-sulfanylidene-1H-pyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 6199734 |
| Molecular Formula | C19H11Cl2N3OS |
| Molecular Weight | 400.29 g/mol |
| Exact Mass | 399.00 |
| IUPAC Name | 5,7-bis(4-chlorophenyl)-2-sulfanylidene-1H-pyrido[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(=S)[nH]c2nc(-c3ccc(Cl)cc3)cc(-c3ccc(Cl)cc3)c12 |
| InChI | InChI=1S/C19H11Cl2N3OS/c20-12-5-1-10(2-6-12)14-9-15(11-3-7-13(21)8-4-11)22-17-16(14)18(25)24-19(26)23-17/h1-9H,(H2,22,23,24,25,26) |
| InChIKey | MMAPUYFVVQUKML-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.29 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|