C21H16ClN3O2S2 — CID 11178208
5-(4-chlorophenyl)-7-(2,4-dimethoxyphenyl)-1H-pyrido[2,3-d]pyrimidine-2,4-dithione (PubChem CID 11178208) has the molecular formula C21H16ClN3O2S2 and a molecular weight of 441.97 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-7-(2,4-dimethoxyphenyl)-1H-pyrido[2,3-d]pyrimidine-2,4-dithione.
| Compound Name | 5-(4-chlorophenyl)-7-(2,4-dimethoxyphenyl)-1H-pyrido[2,3-d]pyrimidine-2,4-dithione |
|---|---|
| PubChem CID | 11178208 |
| Molecular Formula | C21H16ClN3O2S2 |
| Molecular Weight | 441.97 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | 5-(4-chlorophenyl)-7-(2,4-dimethoxyphenyl)-1H-pyrido[2,3-d]pyrimidine-2,4-dithione |
| SMILES | COc1ccc(-c2cc(-c3ccc(Cl)cc3)c3c(=S)[nH]c(=S)[nH]c3n2)c(OC)c1 |
| InChI | InChI=1S/C21H16ClN3O2S2/c1-26-13-7-8-14(17(9-13)27-2)16-10-15(11-3-5-12(22)6-4-11)18-19(23-16)24-21(29)25-20(18)28/h3-10H,1-2H3,(H2,23,24,25,28,29) |
| InChIKey | YLADHHLFNJAPRX-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 62.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.97 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|