C22H17N3O4S2 — CID 10789772
4-amino-5-(1,3-benzodioxol-5-yl)-7-(2,4-dimethoxyphenyl)pyrido[2,3-d][1,3]thiazine-2-thione (PubChem CID 10789772) has the molecular formula C22H17N3O4S2 and a molecular weight of 451.53 g/mol. Its IUPAC name is 4-amino-5-(1,3-benzodioxol-5-yl)-7-(2,4-dimethoxyphenyl)pyrido[2,3-d][1,3]thiazine-2-thione.
| Compound Name | 4-amino-5-(1,3-benzodioxol-5-yl)-7-(2,4-dimethoxyphenyl)pyrido[2,3-d][1,3]thiazine-2-thione |
|---|---|
| PubChem CID | 10789772 |
| Molecular Formula | C22H17N3O4S2 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | 4-amino-5-(1,3-benzodioxol-5-yl)-7-(2,4-dimethoxyphenyl)pyrido[2,3-d][1,3]thiazine-2-thione |
| SMILES | COc1ccc(-c2cc(-c3ccc4c(c3)OCO4)c3c(N)sc(=S)nc3n2)c(OC)c1 |
| InChI | InChI=1S/C22H17N3O4S2/c1-26-12-4-5-13(17(8-12)27-2)15-9-14(11-3-6-16-18(7-11)29-10-28-16)19-20(23)31-22(30)25-21(19)24-15/h3-9H,10,23H2,1-2H3 |
| InChIKey | OKWVWQODLUONTC-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 88.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|