C18H15NO3 — CID 22716442
6-(7-methoxynaphthalen-2-yl)-1,3-benzodioxol-5-amine (PubChem CID 22716442) has the molecular formula C18H15NO3 and a molecular weight of 293.32 g/mol. Its IUPAC name is 6-(7-methoxynaphthalen-2-yl)-1,3-benzodioxol-5-amine.
| Compound Name | 6-(7-methoxynaphthalen-2-yl)-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 22716442 |
| Molecular Formula | C18H15NO3 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 6-(7-methoxynaphthalen-2-yl)-1,3-benzodioxol-5-amine |
| SMILES | COc1ccc2ccc(-c3cc4c(cc3N)OCO4)cc2c1 |
| InChI | InChI=1S/C18H15NO3/c1-20-14-5-4-11-2-3-12(6-13(11)7-14)15-8-17-18(9-16(15)19)22-10-21-17/h2-9H,10,19H2,1H3 |
| InChIKey | RQMRUOBACFZPED-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|