C14H11BrO3 — CID 172909402
5-bromo-6-(3-methoxyphenyl)-1,3-benzodioxole (PubChem CID 172909402) has the molecular formula C14H11BrO3 and a molecular weight of 307.14 g/mol. Its IUPAC name is 5-bromo-6-(3-methoxyphenyl)-1,3-benzodioxole.
| Compound Name | 5-bromo-6-(3-methoxyphenyl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 172909402 |
| Molecular Formula | C14H11BrO3 |
| Molecular Weight | 307.14 g/mol |
| Exact Mass | 305.99 |
| IUPAC Name | 5-bromo-6-(3-methoxyphenyl)-1,3-benzodioxole |
| SMILES | COc1cccc(-c2cc3c(cc2Br)OCO3)c1 |
| InChI | InChI=1S/C14H11BrO3/c1-16-10-4-2-3-9(5-10)11-6-13-14(7-12(11)15)18-8-17-13/h2-7H,8H2,1H3 |
| InChIKey | DGSNOVLFRAUVKQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.14 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |