About 2-cyclopropyl-4-(2,4-dimethoxyphenyl)-1,3-thiazol-5-amine
2-cyclopropyl-4-(2,4-dimethoxyphenyl)-1,3-thiazol-5-amine (PubChem CID 62077685) has the molecular formula C14H16N2O2S
and a molecular weight of 276.36 g/mol. Its IUPAC name is 2-cyclopropyl-4-(2,4-dimethoxyphenyl)-1,3-thiazol-5-amine.
Molecular Properties
| Compound Name | 2-cyclopropyl-4-(2,4-dimethoxyphenyl)-1,3-thiazol-5-amine |
| PubChem CID | 62077685 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 2-cyclopropyl-4-(2,4-dimethoxyphenyl)-1,3-thiazol-5-amine |
| SMILES | COc1ccc(-c2nc(C3CC3)sc2N)c(OC)c1 |
| InChI | InChI=1S/C14H16N2O2S/c1-17-9-5-6-10(11(7-9)18-2)12-13(15)19-14(16-12)8-3-4-8/h5-8H,3-4,15H2,1-2H3 |
| InChIKey | MYIKLQKFKJRADS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-cyclopropyl-4-(2,4-dimethoxyphenyl)-1,3-thiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-4-(2,4-dimethoxyphenyl)-1,3-thiazol-5-amine?
The IUPAC name of 2-cyclopropyl-4-(2,4-dimethoxyphenyl)-1,3-thiazol-5-amine (CID 62077685) is 2-cyclopropyl-4-(2,4-dimethoxyphenyl)-1,3-thiazol-5-amine.
What is the SMILES notation for 2-cyclopropyl-4-(2,4-dimethoxyphenyl)-1,3-thiazol-5-amine?
The canonical SMILES for 2-cyclopropyl-4-(2,4-dimethoxyphenyl)-1,3-thiazol-5-amine is COc1ccc(-c2nc(C3CC3)sc2N)c(OC)c1.
What is the InChIKey of 2-cyclopropyl-4-(2,4-dimethoxyphenyl)-1,3-thiazol-5-amine?
The InChIKey is MYIKLQKFKJRADS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O2S/c1-17-9-5-6-10(11(7-9)18-2)12-13(15)19-14(16-12)8-3-4-8/h5-8H,3-4,15H2,1-2H3.
What are the key properties of 2-cyclopropyl-4-(2,4-dimethoxyphenyl)-1,3-thiazol-5-amine?
2-cyclopropyl-4-(2,4-dimethoxyphenyl)-1,3-thiazol-5-amine has a molecular weight of 276.36 g/mol, XLogP of 3.29, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-4-(2,4-dimethoxyphenyl)-1,3-thiazol-5-amine is sourced from PubChem (CID 62077685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).