C19H12ClFN4S — CID 10068509
4-amino-5-(4-chlorophenyl)-7-(4-fluorophenyl)-3H-pyrido[2,3-d]pyrimidine-2-thione (PubChem CID 10068509) has the molecular formula C19H12ClFN4S and a molecular weight of 382.85 g/mol. Its IUPAC name is 4-amino-5-(4-chlorophenyl)-7-(4-fluorophenyl)-3H-pyrido[2,3-d]pyrimidine-2-thione.
| Compound Name | 4-amino-5-(4-chlorophenyl)-7-(4-fluorophenyl)-3H-pyrido[2,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 10068509 |
| Molecular Formula | C19H12ClFN4S |
| Molecular Weight | 382.85 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 4-amino-5-(4-chlorophenyl)-7-(4-fluorophenyl)-3H-pyrido[2,3-d]pyrimidine-2-thione |
| SMILES | Nc1[nH]c(=S)nc2nc(-c3ccc(F)cc3)cc(-c3ccc(Cl)cc3)c12 |
| InChI | InChI=1S/C19H12ClFN4S/c20-12-5-1-10(2-6-12)14-9-15(11-3-7-13(21)8-4-11)23-18-16(14)17(22)24-19(26)25-18/h1-9H,(H3,22,23,24,25,26) |
| InChIKey | IYNGWKJIHSEJJC-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.85 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|