C25H26N8OS — CID 46217619
4-amino-5-(4-methoxyphenyl)-7-[4-[(4-methylpiperazin-1-yl)diazenyl]phenyl]-3H-pyrido[2,3-d]pyrimidine-2-thione (PubChem CID 46217619) has the molecular formula C25H26N8OS and a molecular weight of 486.61 g/mol. Its IUPAC name is 4-amino-5-(4-methoxyphenyl)-7-[4-[(4-methylpiperazin-1-yl)diazenyl]phenyl]-3H-pyrido[2,3-d]pyrimidine-2-thione.
| Compound Name | 4-amino-5-(4-methoxyphenyl)-7-[4-[(4-methylpiperazin-1-yl)diazenyl]phenyl]-3H-pyrido[2,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 46217619 |
| Molecular Formula | C25H26N8OS |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 4-amino-5-(4-methoxyphenyl)-7-[4-[(4-methylpiperazin-1-yl)diazenyl]phenyl]-3H-pyrido[2,3-d]pyrimidine-2-thione |
| SMILES | COc1ccc(-c2cc(-c3ccc(/N=N/N4CCN(C)CC4)cc3)nc3nc(=S)[nH]c(N)c23)cc1 |
| InChI | InChI=1S/C25H26N8OS/c1-32-11-13-33(14-12-32)31-30-18-7-3-17(4-8-18)21-15-20(16-5-9-19(34-2)10-6-16)22-23(26)28-25(35)29-24(22)27-21/h3-10,15H,11-14H2,1-2H3,(H3,26,27,28,29,35)/b31-30+ |
| InChIKey | FCVZVHUMVCSZNQ-NVQSTNCTSA-N |
| XLogP | 4.86 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|