C20H15N5O4 — CID 10452915
4-amino-5-(4-methoxyphenyl)-7-(4-nitrophenyl)-3H-pyrido[2,3-d]pyrimidin-2-one (PubChem CID 10452915) has the molecular formula C20H15N5O4 and a molecular weight of 389.37 g/mol. Its IUPAC name is 4-amino-5-(4-methoxyphenyl)-7-(4-nitrophenyl)-3H-pyrido[2,3-d]pyrimidin-2-one.
| Compound Name | 4-amino-5-(4-methoxyphenyl)-7-(4-nitrophenyl)-3H-pyrido[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 10452915 |
| Molecular Formula | C20H15N5O4 |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 4-amino-5-(4-methoxyphenyl)-7-(4-nitrophenyl)-3H-pyrido[2,3-d]pyrimidin-2-one |
| SMILES | COc1ccc(-c2cc(-c3ccc([N+](=O)[O-])cc3)nc3nc(=O)[nH]c(N)c23)cc1 |
| InChI | InChI=1S/C20H15N5O4/c1-29-14-8-4-11(5-9-14)15-10-16(12-2-6-13(7-3-12)25(27)28)22-19-17(15)18(21)23-20(26)24-19/h2-10H,1H3,(H3,21,22,23,24,26) |
| InChIKey | WUUWDDINBBFLSN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 137.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|