C19H13ClFN5O — CID 155806988
7-(4-chlorophenyl)-5-(4-fluorophenyl)-2-hydrazinyl-3H-pyrido[2,3-d]pyrimidin-4-one (PubChem CID 155806988) has the molecular formula C19H13ClFN5O and a molecular weight of 381.80 g/mol. Its IUPAC name is 7-(4-chlorophenyl)-5-(4-fluorophenyl)-2-hydrazinyl-3H-pyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 7-(4-chlorophenyl)-5-(4-fluorophenyl)-2-hydrazinyl-3H-pyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 155806988 |
| Molecular Formula | C19H13ClFN5O |
| Molecular Weight | 381.80 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 7-(4-chlorophenyl)-5-(4-fluorophenyl)-2-hydrazinyl-3H-pyrido[2,3-d]pyrimidin-4-one |
| SMILES | NNc1nc2nc(-c3ccc(Cl)cc3)cc(-c3ccc(F)cc3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C19H13ClFN5O/c20-12-5-1-11(2-6-12)15-9-14(10-3-7-13(21)8-4-10)16-17(23-15)24-19(26-22)25-18(16)27/h1-9H,22H2,(H2,23,24,25,26,27) |
| InChIKey | YRPGZDLLTPWAFC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.80 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|