C22H15Cl2F2N3O — CID 52942449
2-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]-3-(4-fluorophenyl)-6H-1,6-naphthyridin-5-one (PubChem CID 52942449) has the molecular formula C22H15Cl2F2N3O and a molecular weight of 446.28 g/mol. Its IUPAC name is 2-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]-3-(4-fluorophenyl)-6H-1,6-naphthyridin-5-one.
| Compound Name | 2-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]-3-(4-fluorophenyl)-6H-1,6-naphthyridin-5-one |
|---|---|
| PubChem CID | 52942449 |
| Molecular Formula | C22H15Cl2F2N3O |
| Molecular Weight | 446.28 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | 2-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]-3-(4-fluorophenyl)-6H-1,6-naphthyridin-5-one |
| SMILES | CC(Nc1nc2cc[nH]c(=O)c2cc1-c1ccc(F)cc1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C22H15Cl2F2N3O/c1-11(14-9-19(26)18(24)10-17(14)23)28-21-15(12-2-4-13(25)5-3-12)8-16-20(29-21)6-7-27-22(16)30/h2-11H,1H3,(H,27,30)(H,28,29) |
| InChIKey | WBSBRCJNWZWMFW-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.28 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|