C25H15Cl2FN4S — CID 15093695
4-amino-5,7-bis(4-chlorophenyl)-3-(2-fluorophenyl)pyrido[2,3-d]pyrimidine-2-thione (PubChem CID 15093695) has the molecular formula C25H15Cl2FN4S and a molecular weight of 493.39 g/mol. Its IUPAC name is 4-amino-5,7-bis(4-chlorophenyl)-3-(2-fluorophenyl)pyrido[2,3-d]pyrimidine-2-thione.
| Compound Name | 4-amino-5,7-bis(4-chlorophenyl)-3-(2-fluorophenyl)pyrido[2,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 15093695 |
| Molecular Formula | C25H15Cl2FN4S |
| Molecular Weight | 493.39 g/mol |
| Exact Mass | 492.04 |
| IUPAC Name | 4-amino-5,7-bis(4-chlorophenyl)-3-(2-fluorophenyl)pyrido[2,3-d]pyrimidine-2-thione |
| SMILES | Nc1c2c(-c3ccc(Cl)cc3)cc(-c3ccc(Cl)cc3)nc2nc(=S)n1-c1ccccc1F |
| InChI | InChI=1S/C25H15Cl2FN4S/c26-16-9-5-14(6-10-16)18-13-20(15-7-11-17(27)12-8-15)30-24-22(18)23(29)32(25(33)31-24)21-4-2-1-3-19(21)28/h1-13H,29H2 |
| InChIKey | NICDFJGNFVMPBY-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.39 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|