C17H13N5OS2 — CID 10021886
11,13-dimethyl-12-phenyldiazenyl-4-sulfanylidene-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-6-one (PubChem CID 10021886) has the molecular formula C17H13N5OS2 and a molecular weight of 367.46 g/mol. Its IUPAC name is 11,13-dimethyl-12-phenyldiazenyl-4-sulfanylidene-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-6-one.
| Compound Name | 11,13-dimethyl-12-phenyldiazenyl-4-sulfanylidene-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-6-one |
|---|---|
| PubChem CID | 10021886 |
| Molecular Formula | C17H13N5OS2 |
| Molecular Weight | 367.46 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 11,13-dimethyl-12-phenyldiazenyl-4-sulfanylidene-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-6-one |
| SMILES | Cc1nc2sc3c(=O)[nH]c(=S)[nH]c3c2c(C)c1/N=N/c1ccccc1 |
| InChI | InChI=1S/C17H13N5OS2/c1-8-11-13-14(15(23)20-17(24)19-13)25-16(11)18-9(2)12(8)22-21-10-6-4-3-5-7-10/h3-7H,1-2H3,(H2,19,20,23,24)/b22-21+ |
| InChIKey | IMXNHNYZOCWYOD-QURGRASLSA-N |
| XLogP | 5.23 |
| TPSA | 86.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.46 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|