C11H11N3S — CID 14222602
(2,4-dimethyl-1,3-thiazol-5-yl)-phenyldiazene (PubChem CID 14222602) has the molecular formula C11H11N3S and a molecular weight of 217.30 g/mol. Its IUPAC name is (2,4-dimethyl-1,3-thiazol-5-yl)-phenyldiazene.
| Compound Name | (2,4-dimethyl-1,3-thiazol-5-yl)-phenyldiazene |
|---|---|
| PubChem CID | 14222602 |
| Molecular Formula | C11H11N3S |
| Molecular Weight | 217.30 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | (2,4-dimethyl-1,3-thiazol-5-yl)-phenyldiazene |
| SMILES | Cc1nc(C)c(/N=N/c2ccccc2)s1 |
| InChI | InChI=1S/C11H11N3S/c1-8-11(15-9(2)12-8)14-13-10-6-4-3-5-7-10/h3-7H,1-2H3/b14-13+ |
| InChIKey | ZTUATKLIRHCVAI-BUHFOSPRSA-N |
| XLogP | 4.18 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.30 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|