C13H12BrNS — CID 169260165
5-bromo-4-methyl-2-[(E)-3-phenylprop-1-enyl]-1,3-thiazole (PubChem CID 169260165) has the molecular formula C13H12BrNS and a molecular weight of 294.22 g/mol. Its IUPAC name is 5-bromo-4-methyl-2-[(E)-3-phenylprop-1-enyl]-1,3-thiazole.
| Compound Name | 5-bromo-4-methyl-2-[(E)-3-phenylprop-1-enyl]-1,3-thiazole |
|---|---|
| PubChem CID | 169260165 |
| Molecular Formula | C13H12BrNS |
| Molecular Weight | 294.22 g/mol |
| Exact Mass | 292.99 |
| IUPAC Name | 5-bromo-4-methyl-2-[(E)-3-phenylprop-1-enyl]-1,3-thiazole |
| SMILES | Cc1nc(/C=C/Cc2ccccc2)sc1Br |
| InChI | InChI=1S/C13H12BrNS/c1-10-13(14)16-12(15-10)9-5-8-11-6-3-2-4-7-11/h2-7,9H,8H2,1H3/b9-5+ |
| InChIKey | JIJBFBMDEYQAPC-WEVVVXLNSA-N |
| XLogP | 4.47 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.22 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |