C13H9N3OS — CID 137227991
2-phenyldiazenylthieno[2,3-b]pyridin-3-ol (PubChem CID 137227991) has the molecular formula C13H9N3OS and a molecular weight of 255.30 g/mol. Its IUPAC name is 2-phenyldiazenylthieno[2,3-b]pyridin-3-ol.
| Compound Name | 2-phenyldiazenylthieno[2,3-b]pyridin-3-ol |
|---|---|
| PubChem CID | 137227991 |
| Molecular Formula | C13H9N3OS |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 2-phenyldiazenylthieno[2,3-b]pyridin-3-ol |
| SMILES | Oc1c(/N=N/c2ccccc2)sc2ncccc12 |
| InChI | InChI=1S/C13H9N3OS/c17-11-10-7-4-8-14-12(10)18-13(11)16-15-9-5-2-1-3-6-9/h1-8,17H/b16-15+ |
| InChIKey | VFTFJXMBNYIPNZ-FOCLMDBBSA-N |
| XLogP | 4.42 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|