C8H5KN2OS — CID 173437283
potassium;hydride;3-hydroxythieno[2,3-b]pyridine-2-carbonitrile (PubChem CID 173437283) has the molecular formula C8H5KN2OS and a molecular weight of 216.31 g/mol. Its IUPAC name is potassium;hydride;3-hydroxythieno[2,3-b]pyridine-2-carbonitrile.
| Compound Name | potassium;hydride;3-hydroxythieno[2,3-b]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 173437283 |
| Molecular Formula | C8H5KN2OS |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 215.98 |
| IUPAC Name | potassium;hydride;3-hydroxythieno[2,3-b]pyridine-2-carbonitrile |
| SMILES | N#Cc1sc2ncccc2c1O.[H-].[K+] |
| InChI | InChI=1S/C8H4N2OS.K.H/c9-4-6-7(11)5-2-1-3-10-8(5)12-6;;/h1-3,11H;;/q;+1;-1 |
| InChIKey | OUBAUAMBRKKKAE-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 56.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|