C11H8N2S — CID 118860905
[1]benzothiolo[2,3-b]pyridin-8-amine (PubChem CID 118860905) has the molecular formula C11H8N2S and a molecular weight of 200.27 g/mol. Its IUPAC name is [1]benzothiolo[2,3-b]pyridin-8-amine.
| Compound Name | [1]benzothiolo[2,3-b]pyridin-8-amine |
|---|---|
| PubChem CID | 118860905 |
| Molecular Formula | C11H8N2S |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | [1]benzothiolo[2,3-b]pyridin-8-amine |
| SMILES | Nc1cccc2c1sc1ncccc12 |
| InChI | InChI=1S/C11H8N2S/c12-9-5-1-3-7-8-4-2-6-13-11(8)14-10(7)9/h1-6H,12H2 |
| InChIKey | NATUAACUMIBVOI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|