C11H8N2OS — CID 119087007
2-(furan-2-yl)thieno[2,3-b]pyridin-3-amine (PubChem CID 119087007) has the molecular formula C11H8N2OS and a molecular weight of 216.27 g/mol. Its IUPAC name is 2-(furan-2-yl)thieno[2,3-b]pyridin-3-amine.
| Compound Name | 2-(furan-2-yl)thieno[2,3-b]pyridin-3-amine |
|---|---|
| PubChem CID | 119087007 |
| Molecular Formula | C11H8N2OS |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 2-(furan-2-yl)thieno[2,3-b]pyridin-3-amine |
| SMILES | Nc1c(-c2ccco2)sc2ncccc12 |
| InChI | InChI=1S/C11H8N2OS/c12-9-7-3-1-5-13-11(7)15-10(9)8-4-2-6-14-8/h1-6H,12H2 |
| InChIKey | OERMPUXTLPRYKO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |