C14H13N3OS — CID 143488204
3-aminothieno[2,3-b]pyridine-2-carbaldehyde;aniline (PubChem CID 143488204) has the molecular formula C14H13N3OS and a molecular weight of 271.35 g/mol. Its IUPAC name is 3-aminothieno[2,3-b]pyridine-2-carbaldehyde;aniline.
| Compound Name | 3-aminothieno[2,3-b]pyridine-2-carbaldehyde;aniline |
|---|---|
| PubChem CID | 143488204 |
| Molecular Formula | C14H13N3OS |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 3-aminothieno[2,3-b]pyridine-2-carbaldehyde;aniline |
| SMILES | Nc1c(C=O)sc2ncccc12.Nc1ccccc1 |
| InChI | InChI=1S/C8H6N2OS.C6H7N/c9-7-5-2-1-3-10-8(5)12-6(7)4-11;7-6-4-2-1-3-5-6/h1-4H,9H2;1-5H,7H2 |
| InChIKey | BVUSGPCWLBVWAU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|