C17H13NO4S — CID 139601090
2-[4-(3-hydroxythieno[2,3-b]pyridine-2-carbonyl)phenyl]propanoic acid (PubChem CID 139601090) has the molecular formula C17H13NO4S and a molecular weight of 327.36 g/mol. Its IUPAC name is 2-[4-(3-hydroxythieno[2,3-b]pyridine-2-carbonyl)phenyl]propanoic acid.
| Compound Name | 2-[4-(3-hydroxythieno[2,3-b]pyridine-2-carbonyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 139601090 |
| Molecular Formula | C17H13NO4S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 2-[4-(3-hydroxythieno[2,3-b]pyridine-2-carbonyl)phenyl]propanoic acid |
| SMILES | CC(C(=O)O)c1ccc(C(=O)c2sc3ncccc3c2O)cc1 |
| InChI | InChI=1S/C17H13NO4S/c1-9(17(21)22)10-4-6-11(7-5-10)13(19)15-14(20)12-3-2-8-18-16(12)23-15/h2-9,20H,1H3,(H,21,22) |
| InChIKey | UIKKJTTYRZPSDI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|