C23H23N7O2S3 — CID 177496713
4-methyl-N-[4-methyl-5-[(E)-C-methyl-N-[(4-methyl-5-phenyldiazenyl-1,3-thiazol-2-yl)amino]carbonimidoyl]-1,3-thiazol-2-yl]benzenesulfonamide (PubChem CID 177496713) has the molecular formula C23H23N7O2S3 and a molecular weight of 525.69 g/mol. Its IUPAC name is 4-methyl-N-[4-methyl-5-[(E)-C-methyl-N-[(4-methyl-5-phenyldiazenyl-1,3-thiazol-2-yl)amino]carbonimidoyl]-1,3-thiazol-2-yl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[4-methyl-5-[(E)-C-methyl-N-[(4-methyl-5-phenyldiazenyl-1,3-thiazol-2-yl)amino]carbonimidoyl]-1,3-thiazol-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 177496713 |
| Molecular Formula | C23H23N7O2S3 |
| Molecular Weight | 525.69 g/mol |
| Exact Mass | 525.11 |
| IUPAC Name | 4-methyl-N-[4-methyl-5-[(E)-C-methyl-N-[(4-methyl-5-phenyldiazenyl-1,3-thiazol-2-yl)amino]carbonimidoyl]-1,3-thiazol-2-yl]benzenesulfonamide |
| SMILES | C/C(=N\Nc1nc(C)c(/N=N/c2ccccc2)s1)c1sc(NS(=O)(=O)c2ccc(C)cc2)nc1C |
| InChI | InChI=1S/C23H23N7O2S3/c1-14-10-12-19(13-11-14)35(31,32)30-23-24-15(2)20(33-23)16(3)26-29-22-25-17(4)21(34-22)28-27-18-8-6-5-7-9-18/h5-13H,1-4H3,(H,24,30)(H,25,29)/b26-16+,28-27+ |
| InChIKey | RLLIPMHMBXFRDF-JLAZDCSASA-N |
| XLogP | 6.58 |
| TPSA | 121.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.69 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|