C19H22N6O2 — CID 136864725
5-butyl-4-methyl-2-(5-methyl-3-oxo-4-phenyldiazenyl-1H-pyrazol-2-yl)-1H-pyrimidin-6-one (PubChem CID 136864725) has the molecular formula C19H22N6O2 and a molecular weight of 366.43 g/mol. Its IUPAC name is 5-butyl-4-methyl-2-(5-methyl-3-oxo-4-phenyldiazenyl-1H-pyrazol-2-yl)-1H-pyrimidin-6-one.
| Compound Name | 5-butyl-4-methyl-2-(5-methyl-3-oxo-4-phenyldiazenyl-1H-pyrazol-2-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136864725 |
| Molecular Formula | C19H22N6O2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 5-butyl-4-methyl-2-(5-methyl-3-oxo-4-phenyldiazenyl-1H-pyrazol-2-yl)-1H-pyrimidin-6-one |
| SMILES | CCCCc1c(C)nc(-n2[nH]c(C)c(/N=N/c3ccccc3)c2=O)[nH]c1=O |
| InChI | InChI=1S/C19H22N6O2/c1-4-5-11-15-12(2)20-19(21-17(15)26)25-18(27)16(13(3)24-25)23-22-14-9-7-6-8-10-14/h6-10,24H,4-5,11H2,1-3H3,(H,20,21,26)/b23-22+ |
| InChIKey | BHDLPYDYEXBWJY-GHVJWSGMSA-N |
| XLogP | 3.62 |
| TPSA | 108.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|