C19H20N6O4 — CID 136864749
4-[[5-methyl-2-(4-methyl-6-oxo-5-propyl-1H-pyrimidin-2-yl)-3-oxo-1H-pyrazol-4-yl]diazenyl]benzoic acid (PubChem CID 136864749) has the molecular formula C19H20N6O4 and a molecular weight of 396.41 g/mol. Its IUPAC name is 4-[[5-methyl-2-(4-methyl-6-oxo-5-propyl-1H-pyrimidin-2-yl)-3-oxo-1H-pyrazol-4-yl]diazenyl]benzoic acid.
| Compound Name | 4-[[5-methyl-2-(4-methyl-6-oxo-5-propyl-1H-pyrimidin-2-yl)-3-oxo-1H-pyrazol-4-yl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 136864749 |
| Molecular Formula | C19H20N6O4 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 4-[[5-methyl-2-(4-methyl-6-oxo-5-propyl-1H-pyrimidin-2-yl)-3-oxo-1H-pyrazol-4-yl]diazenyl]benzoic acid |
| SMILES | CCCc1c(C)nc(-n2[nH]c(C)c(/N=N/c3ccc(C(=O)O)cc3)c2=O)[nH]c1=O |
| InChI | InChI=1S/C19H20N6O4/c1-4-5-14-10(2)20-19(21-16(14)26)25-17(27)15(11(3)24-25)23-22-13-8-6-12(7-9-13)18(28)29/h6-9,24H,4-5H2,1-3H3,(H,28,29)(H,20,21,26)/b23-22+ |
| InChIKey | KIUCCCLLOQJESJ-GHVJWSGMSA-N |
| XLogP | 2.93 |
| TPSA | 145.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|