C16H13ClN6O3 — CID 136864907
4-[[2-(4-chloro-6-methylpyrimidin-2-yl)-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]benzoic acid (PubChem CID 136864907) has the molecular formula C16H13ClN6O3 and a molecular weight of 372.77 g/mol. Its IUPAC name is 4-[[2-(4-chloro-6-methylpyrimidin-2-yl)-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]benzoic acid.
| Compound Name | 4-[[2-(4-chloro-6-methylpyrimidin-2-yl)-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 136864907 |
| Molecular Formula | C16H13ClN6O3 |
| Molecular Weight | 372.77 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 4-[[2-(4-chloro-6-methylpyrimidin-2-yl)-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]benzoic acid |
| SMILES | Cc1cc(Cl)nc(-n2[nH]c(C)c(/N=N/c3ccc(C(=O)O)cc3)c2=O)n1 |
| InChI | InChI=1S/C16H13ClN6O3/c1-8-7-12(17)19-16(18-8)23-14(24)13(9(2)22-23)21-20-11-5-3-10(4-6-11)15(25)26/h3-7,22H,1-2H3,(H,25,26)/b21-20+ |
| InChIKey | GPUOJUFAYBGNKO-QZQOTICOSA-N |
| XLogP | 3.34 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.77 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|