C18H19ClN6O — CID 136864868
2-(4-chloro-5-ethyl-6-methylpyrimidin-2-yl)-5-methyl-4-[(4-methylphenyl)diazenyl]-1H-pyrazol-3-one (PubChem CID 136864868) has the molecular formula C18H19ClN6O and a molecular weight of 370.84 g/mol. Its IUPAC name is 2-(4-chloro-5-ethyl-6-methylpyrimidin-2-yl)-5-methyl-4-[(4-methylphenyl)diazenyl]-1H-pyrazol-3-one.
| Compound Name | 2-(4-chloro-5-ethyl-6-methylpyrimidin-2-yl)-5-methyl-4-[(4-methylphenyl)diazenyl]-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 136864868 |
| Molecular Formula | C18H19ClN6O |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 2-(4-chloro-5-ethyl-6-methylpyrimidin-2-yl)-5-methyl-4-[(4-methylphenyl)diazenyl]-1H-pyrazol-3-one |
| SMILES | CCc1c(C)nc(-n2[nH]c(C)c(/N=N/c3ccc(C)cc3)c2=O)nc1Cl |
| InChI | InChI=1S/C18H19ClN6O/c1-5-14-11(3)20-18(21-16(14)19)25-17(26)15(12(4)24-25)23-22-13-8-6-10(2)7-9-13/h6-9,24H,5H2,1-4H3/b23-22+ |
| InChIKey | RBUJUIGIIQOOGM-GHVJWSGMSA-N |
| XLogP | 4.51 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|