C19H21BrN6O2 — CID 136864900
4-[(4-bromophenyl)diazenyl]-2-(4-ethoxy-5-ethyl-6-methylpyrimidin-2-yl)-5-methyl-1H-pyrazol-3-one (PubChem CID 136864900) has the molecular formula C19H21BrN6O2 and a molecular weight of 445.32 g/mol. Its IUPAC name is 4-[(4-bromophenyl)diazenyl]-2-(4-ethoxy-5-ethyl-6-methylpyrimidin-2-yl)-5-methyl-1H-pyrazol-3-one.
| Compound Name | 4-[(4-bromophenyl)diazenyl]-2-(4-ethoxy-5-ethyl-6-methylpyrimidin-2-yl)-5-methyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 136864900 |
| Molecular Formula | C19H21BrN6O2 |
| Molecular Weight | 445.32 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | 4-[(4-bromophenyl)diazenyl]-2-(4-ethoxy-5-ethyl-6-methylpyrimidin-2-yl)-5-methyl-1H-pyrazol-3-one |
| SMILES | CCOc1nc(-n2[nH]c(C)c(/N=N/c3ccc(Br)cc3)c2=O)nc(C)c1CC |
| InChI | InChI=1S/C19H21BrN6O2/c1-5-15-11(3)21-19(22-17(15)28-6-2)26-18(27)16(12(4)25-26)24-23-14-9-7-13(20)8-10-14/h7-10,25H,5-6H2,1-4H3/b24-23+ |
| InChIKey | VRHFRUNHPJQDOO-WCWDXBQESA-N |
| XLogP | 4.71 |
| TPSA | 97.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.32 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|