C16H15N7O4 — CID 136864938
2-(4-methoxy-6-methylpyrimidin-2-yl)-5-methyl-4-[(4-nitrophenyl)diazenyl]-1H-pyrazol-3-one (PubChem CID 136864938) has the molecular formula C16H15N7O4 and a molecular weight of 369.34 g/mol. Its IUPAC name is 2-(4-methoxy-6-methylpyrimidin-2-yl)-5-methyl-4-[(4-nitrophenyl)diazenyl]-1H-pyrazol-3-one.
| Compound Name | 2-(4-methoxy-6-methylpyrimidin-2-yl)-5-methyl-4-[(4-nitrophenyl)diazenyl]-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 136864938 |
| Molecular Formula | C16H15N7O4 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 2-(4-methoxy-6-methylpyrimidin-2-yl)-5-methyl-4-[(4-nitrophenyl)diazenyl]-1H-pyrazol-3-one |
| SMILES | COc1cc(C)nc(-n2[nH]c(C)c(/N=N/c3ccc([N+](=O)[O-])cc3)c2=O)n1 |
| InChI | InChI=1S/C16H15N7O4/c1-9-8-13(27-3)18-16(17-9)22-15(24)14(10(2)21-22)20-19-11-4-6-12(7-5-11)23(25)26/h4-8,21H,1-3H3/b20-19+ |
| InChIKey | ODTCBFJAIUDOOL-FMQUCBEESA-N |
| XLogP | 2.90 |
| TPSA | 140.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|