C17H12N5O5- — CID 135789084
3-[[5-methyl-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-4-yl]diazenyl]benzoate (PubChem CID 135789084) has the molecular formula C17H12N5O5- and a molecular weight of 366.31 g/mol. Its IUPAC name is 3-[[5-methyl-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-4-yl]diazenyl]benzoate.
| Compound Name | 3-[[5-methyl-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-4-yl]diazenyl]benzoate |
|---|---|
| PubChem CID | 135789084 |
| Molecular Formula | C17H12N5O5- |
| Molecular Weight | 366.31 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 3-[[5-methyl-2-(4-nitrophenyl)-3-oxo-1H-pyrazol-4-yl]diazenyl]benzoate |
| SMILES | Cc1[nH]n(-c2ccc([N+](=O)[O-])cc2)c(=O)c1/N=N/c1cccc(C(=O)[O-])c1 |
| InChI | InChI=1S/C17H13N5O5/c1-10-15(19-18-12-4-2-3-11(9-12)17(24)25)16(23)21(20-10)13-5-7-14(8-6-13)22(26)27/h2-9,20H,1H3,(H,24,25)/p-1/b19-18+ |
| InChIKey | HAFDEMVPRIWLPS-VHEBQXMUSA-M |
| XLogP | 2.16 |
| TPSA | 145.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|