C18H15N5OS — CID 3120438
5-methyl-4-[(2-methyl-1,3-benzothiazol-6-yl)diazenyl]-2-phenyl-1H-pyrazol-3-one (PubChem CID 3120438) has the molecular formula C18H15N5OS and a molecular weight of 349.42 g/mol. Its IUPAC name is 5-methyl-4-[(2-methyl-1,3-benzothiazol-6-yl)diazenyl]-2-phenyl-1H-pyrazol-3-one.
| Compound Name | 5-methyl-4-[(2-methyl-1,3-benzothiazol-6-yl)diazenyl]-2-phenyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 3120438 |
| Molecular Formula | C18H15N5OS |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 5-methyl-4-[(2-methyl-1,3-benzothiazol-6-yl)diazenyl]-2-phenyl-1H-pyrazol-3-one |
| SMILES | Cc1nc2ccc(/N=N/c3c(C)[nH]n(-c4ccccc4)c3=O)cc2s1 |
| InChI | InChI=1S/C18H15N5OS/c1-11-17(18(24)23(22-11)14-6-4-3-5-7-14)21-20-13-8-9-15-16(10-13)25-12(2)19-15/h3-10,22H,1-2H3/b21-20+ |
| InChIKey | LQCFPWYTRNCSLB-QZQOTICOSA-N |
| XLogP | 4.81 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|