C21H16ClN5OS — CID 10812147
3-(4-chlorophenyl)-5,7-dimethyl-6-phenyldiazenyl-2-sulfanylidene-1H-pyrido[2,3-d]pyrimidin-4-one (PubChem CID 10812147) has the molecular formula C21H16ClN5OS and a molecular weight of 421.91 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-5,7-dimethyl-6-phenyldiazenyl-2-sulfanylidene-1H-pyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 3-(4-chlorophenyl)-5,7-dimethyl-6-phenyldiazenyl-2-sulfanylidene-1H-pyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 10812147 |
| Molecular Formula | C21H16ClN5OS |
| Molecular Weight | 421.91 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 3-(4-chlorophenyl)-5,7-dimethyl-6-phenyldiazenyl-2-sulfanylidene-1H-pyrido[2,3-d]pyrimidin-4-one |
| SMILES | Cc1nc2[nH]c(=S)n(-c3ccc(Cl)cc3)c(=O)c2c(C)c1/N=N/c1ccccc1 |
| InChI | InChI=1S/C21H16ClN5OS/c1-12-17-19(23-13(2)18(12)26-25-15-6-4-3-5-7-15)24-21(29)27(20(17)28)16-10-8-14(22)9-11-16/h3-11H,1-2H3,(H,23,24,29)/b26-25+ |
| InChIKey | UNDUAEMNXKJFRU-OCEACIFDSA-N |
| XLogP | 6.13 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.91 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|