C21H15ClN2S — CID 23629014
3-(4-chlorophenyl)-4,5-diphenyl-1H-imidazole-2-thione (PubChem CID 23629014) has the molecular formula C21H15ClN2S and a molecular weight of 362.89 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4,5-diphenyl-1H-imidazole-2-thione.
| Compound Name | 3-(4-chlorophenyl)-4,5-diphenyl-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 23629014 |
| Molecular Formula | C21H15ClN2S |
| Molecular Weight | 362.89 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 3-(4-chlorophenyl)-4,5-diphenyl-1H-imidazole-2-thione |
| SMILES | S=c1[nH]c(-c2ccccc2)c(-c2ccccc2)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H15ClN2S/c22-17-11-13-18(14-12-17)24-20(16-9-5-2-6-10-16)19(23-21(24)25)15-7-3-1-4-8-15/h1-14H,(H,23,25) |
| InChIKey | FESRNLWPRXHNJS-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.89 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|