C21H16N2OS — CID 10088880
3-(3-hydroxyphenyl)-4,5-diphenyl-1H-imidazole-2-thione (PubChem CID 10088880) has the molecular formula C21H16N2OS and a molecular weight of 344.44 g/mol. Its IUPAC name is 3-(3-hydroxyphenyl)-4,5-diphenyl-1H-imidazole-2-thione.
| Compound Name | 3-(3-hydroxyphenyl)-4,5-diphenyl-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 10088880 |
| Molecular Formula | C21H16N2OS |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 3-(3-hydroxyphenyl)-4,5-diphenyl-1H-imidazole-2-thione |
| SMILES | Oc1cccc(-n2c(-c3ccccc3)c(-c3ccccc3)[nH]c2=S)c1 |
| InChI | InChI=1S/C21H16N2OS/c24-18-13-7-12-17(14-18)23-20(16-10-5-2-6-11-16)19(22-21(23)25)15-8-3-1-4-9-15/h1-14,24H,(H,22,25) |
| InChIKey | ITTKBLFMKWYGQC-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 40.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|